C12H11N3O7S — CID 118737453
(E)-4-[[4-(benzenesulfonyl)-5-oxido-1,2,5-oxadiazol-5-ium-3-yl]oxy]-N-hydroxybut-2-enamide (PubChem CID 118737453) has the molecular formula C12H11N3O7S and a molecular weight of 341.30 g/mol. Its IUPAC name is (E)-4-[[4-(benzenesulfonyl)-5-oxido-1,2,5-oxadiazol-5-ium-3-yl]oxy]-N-hydroxybut-2-enamide.
| Compound Name | (E)-4-[[4-(benzenesulfonyl)-5-oxido-1,2,5-oxadiazol-5-ium-3-yl]oxy]-N-hydroxybut-2-enamide |
|---|---|
| PubChem CID | 118737453 |
| Molecular Formula | C12H11N3O7S |
| Molecular Weight | 341.30 g/mol |
| Exact Mass | 341.03 |
| IUPAC Name | (E)-4-[[4-(benzenesulfonyl)-5-oxido-1,2,5-oxadiazol-5-ium-3-yl]oxy]-N-hydroxybut-2-enamide |
| SMILES | O=C(/C=C/COc1no[n+]([O-])c1S(=O)(=O)c1ccccc1)NO |
| InChI | InChI=1S/C12H11N3O7S/c16-10(13-17)7-4-8-21-11-12(15(18)22-14-11)23(19,20)9-5-2-1-3-6-9/h1-7,17H,8H2,(H,13,16)/b7-4+ |
| InChIKey | OONQEODWFASAMP-QPJJXVBHSA-N |
| XLogP | -0.42 |
| TPSA | 145.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.30 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|