C13H15N3O7S — CID 86344451
3-[[4-(benzenesulfonyl)-5-oxido-1,2,5-oxadiazol-5-ium-3-yl]oxy]-N-hydroxy-2,2-dimethylpropanamide (PubChem CID 86344451) has the molecular formula C13H15N3O7S and a molecular weight of 357.34 g/mol. Its IUPAC name is 3-[[4-(benzenesulfonyl)-5-oxido-1,2,5-oxadiazol-5-ium-3-yl]oxy]-N-hydroxy-2,2-dimethylpropanamide.
| Compound Name | 3-[[4-(benzenesulfonyl)-5-oxido-1,2,5-oxadiazol-5-ium-3-yl]oxy]-N-hydroxy-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 86344451 |
| Molecular Formula | C13H15N3O7S |
| Molecular Weight | 357.34 g/mol |
| Exact Mass | 357.06 |
| IUPAC Name | 3-[[4-(benzenesulfonyl)-5-oxido-1,2,5-oxadiazol-5-ium-3-yl]oxy]-N-hydroxy-2,2-dimethylpropanamide |
| SMILES | CC(C)(COc1no[n+]([O-])c1S(=O)(=O)c1ccccc1)C(=O)NO |
| InChI | InChI=1S/C13H15N3O7S/c1-13(2,12(17)14-18)8-22-10-11(16(19)23-15-10)24(20,21)9-6-4-3-5-7-9/h3-7,18H,8H2,1-2H3,(H,14,17) |
| InChIKey | CKIOCYJHWWFBFI-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 145.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.34 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|