C12H15N3O5S — CID 10470819
2-[[4-(benzenesulfonyl)-5-oxido-1,2,5-oxadiazol-5-ium-3-yl]oxy]-N,N-dimethylethanamine (PubChem CID 10470819) has the molecular formula C12H15N3O5S and a molecular weight of 313.34 g/mol. Its IUPAC name is 2-[[4-(benzenesulfonyl)-5-oxido-1,2,5-oxadiazol-5-ium-3-yl]oxy]-N,N-dimethylethanamine.
| Compound Name | 2-[[4-(benzenesulfonyl)-5-oxido-1,2,5-oxadiazol-5-ium-3-yl]oxy]-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 10470819 |
| Molecular Formula | C12H15N3O5S |
| Molecular Weight | 313.34 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | 2-[[4-(benzenesulfonyl)-5-oxido-1,2,5-oxadiazol-5-ium-3-yl]oxy]-N,N-dimethylethanamine |
| SMILES | CN(C)CCOc1no[n+]([O-])c1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C12H15N3O5S/c1-14(2)8-9-19-11-12(15(16)20-13-11)21(17,18)10-6-4-3-5-7-10/h3-7H,8-9H2,1-2H3 |
| InChIKey | DMAVKLVAJOVWPA-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 99.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.34 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'} |
|---|