C13H14N2O7S — CID 86344087
3-[[4-(benzenesulfonyl)-5-oxido-1,2,5-oxadiazol-5-ium-3-yl]oxy]-2,2-dimethylpropanoic acid (PubChem CID 86344087) has the molecular formula C13H14N2O7S and a molecular weight of 342.33 g/mol. Its IUPAC name is 3-[[4-(benzenesulfonyl)-5-oxido-1,2,5-oxadiazol-5-ium-3-yl]oxy]-2,2-dimethylpropanoic acid.
| Compound Name | 3-[[4-(benzenesulfonyl)-5-oxido-1,2,5-oxadiazol-5-ium-3-yl]oxy]-2,2-dimethylpropanoic acid |
|---|---|
| PubChem CID | 86344087 |
| Molecular Formula | C13H14N2O7S |
| Molecular Weight | 342.33 g/mol |
| Exact Mass | 342.05 |
| IUPAC Name | 3-[[4-(benzenesulfonyl)-5-oxido-1,2,5-oxadiazol-5-ium-3-yl]oxy]-2,2-dimethylpropanoic acid |
| SMILES | CC(C)(COc1no[n+]([O-])c1S(=O)(=O)c1ccccc1)C(=O)O |
| InChI | InChI=1S/C13H14N2O7S/c1-13(2,12(16)17)8-21-10-11(15(18)22-14-10)23(19,20)9-6-4-3-5-7-9/h3-7H,8H2,1-2H3,(H,16,17) |
| InChIKey | YTVFHHISNCGARJ-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 133.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.33 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'} |
|---|