C16H14N4O6S — CID 10023265
N-[2-[[4-(benzenesulfonyl)-5-oxido-1,2,5-oxadiazol-5-ium-3-yl]oxy]ethyl]pyridine-3-carboxamide (PubChem CID 10023265) has the molecular formula C16H14N4O6S and a molecular weight of 390.38 g/mol. Its IUPAC name is N-[2-[[4-(benzenesulfonyl)-5-oxido-1,2,5-oxadiazol-5-ium-3-yl]oxy]ethyl]pyridine-3-carboxamide.
| Compound Name | N-[2-[[4-(benzenesulfonyl)-5-oxido-1,2,5-oxadiazol-5-ium-3-yl]oxy]ethyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 10023265 |
| Molecular Formula | C16H14N4O6S |
| Molecular Weight | 390.38 g/mol |
| Exact Mass | 390.06 |
| IUPAC Name | N-[2-[[4-(benzenesulfonyl)-5-oxido-1,2,5-oxadiazol-5-ium-3-yl]oxy]ethyl]pyridine-3-carboxamide |
| SMILES | O=C(NCCOc1no[n+]([O-])c1S(=O)(=O)c1ccccc1)c1cccnc1 |
| InChI | InChI=1S/C16H14N4O6S/c21-14(12-5-4-8-17-11-12)18-9-10-25-15-16(20(22)26-19-15)27(23,24)13-6-2-1-3-7-13/h1-8,11H,9-10H2,(H,18,21) |
| InChIKey | NPLKJTLLGXIOPY-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 138.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.38 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'} |
|---|