C20H16N4O7S — CID 172776469
7-[1-[[4-(benzenesulfonyl)-5-oxido-1,2,5-oxadiazol-5-ium-3-yl]oxy]propan-2-ylamino]quinoline-5,8-dione (PubChem CID 172776469) has the molecular formula C20H16N4O7S and a molecular weight of 456.44 g/mol. Its IUPAC name is 7-[1-[[4-(benzenesulfonyl)-5-oxido-1,2,5-oxadiazol-5-ium-3-yl]oxy]propan-2-ylamino]quinoline-5,8-dione.
| Compound Name | 7-[1-[[4-(benzenesulfonyl)-5-oxido-1,2,5-oxadiazol-5-ium-3-yl]oxy]propan-2-ylamino]quinoline-5,8-dione |
|---|---|
| PubChem CID | 172776469 |
| Molecular Formula | C20H16N4O7S |
| Molecular Weight | 456.44 g/mol |
| Exact Mass | 456.07 |
| IUPAC Name | 7-[1-[[4-(benzenesulfonyl)-5-oxido-1,2,5-oxadiazol-5-ium-3-yl]oxy]propan-2-ylamino]quinoline-5,8-dione |
| SMILES | CC(COc1no[n+]([O-])c1S(=O)(=O)c1ccccc1)NC1=CC(=O)c2cccnc2C1=O |
| InChI | InChI=1S/C20H16N4O7S/c1-12(22-15-10-16(25)14-8-5-9-21-17(14)18(15)26)11-30-19-20(24(27)31-23-19)32(28,29)13-6-3-2-4-7-13/h2-10,12,22H,11H2,1H3 |
| InChIKey | NQVHXPXHNHGSEV-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 155.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.44 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'} |
|---|