C22H20N4O7S — CID 172688271
6-[5-[[4-(benzenesulfonyl)-5-oxido-1,2,5-oxadiazol-5-ium-3-yl]oxy]pentylamino]quinoline-5,8-dione (PubChem CID 172688271) has the molecular formula C22H20N4O7S and a molecular weight of 484.49 g/mol. Its IUPAC name is 6-[5-[[4-(benzenesulfonyl)-5-oxido-1,2,5-oxadiazol-5-ium-3-yl]oxy]pentylamino]quinoline-5,8-dione.
| Compound Name | 6-[5-[[4-(benzenesulfonyl)-5-oxido-1,2,5-oxadiazol-5-ium-3-yl]oxy]pentylamino]quinoline-5,8-dione |
|---|---|
| PubChem CID | 172688271 |
| Molecular Formula | C22H20N4O7S |
| Molecular Weight | 484.49 g/mol |
| Exact Mass | 484.11 |
| IUPAC Name | 6-[5-[[4-(benzenesulfonyl)-5-oxido-1,2,5-oxadiazol-5-ium-3-yl]oxy]pentylamino]quinoline-5,8-dione |
| SMILES | O=C1C(NCCCCCOc2no[n+]([O-])c2S(=O)(=O)c2ccccc2)=CC(=O)c2ncccc21 |
| InChI | InChI=1S/C22H20N4O7S/c27-18-14-17(20(28)16-10-7-12-24-19(16)18)23-11-5-2-6-13-32-21-22(26(29)33-25-21)34(30,31)15-8-3-1-4-9-15/h1,3-4,7-10,12,14,23H,2,5-6,11,13H2 |
| InChIKey | BIEQONLWDZMZRK-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 155.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.49 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'} |
|---|