C16H14N4O5S — CID 102240418
N-[2-[[4-(benzenesulfonyl)-1,2,5-oxadiazol-3-yl]oxy]ethyl]pyridine-3-carboxamide (PubChem CID 102240418) has the molecular formula C16H14N4O5S and a molecular weight of 374.38 g/mol. Its IUPAC name is N-[2-[[4-(benzenesulfonyl)-1,2,5-oxadiazol-3-yl]oxy]ethyl]pyridine-3-carboxamide.
| Compound Name | N-[2-[[4-(benzenesulfonyl)-1,2,5-oxadiazol-3-yl]oxy]ethyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 102240418 |
| Molecular Formula | C16H14N4O5S |
| Molecular Weight | 374.38 g/mol |
| Exact Mass | 374.07 |
| IUPAC Name | N-[2-[[4-(benzenesulfonyl)-1,2,5-oxadiazol-3-yl]oxy]ethyl]pyridine-3-carboxamide |
| SMILES | O=C(NCCOc1nonc1S(=O)(=O)c1ccccc1)c1cccnc1 |
| InChI | InChI=1S/C16H14N4O5S/c21-14(12-5-4-8-17-11-12)18-9-10-24-15-16(20-25-19-15)26(22,23)13-6-2-1-3-7-13/h1-8,11H,9-10H2,(H,18,21) |
| InChIKey | RKDHYLFKDBNHOP-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 124.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.38 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|