C12H12N2O7S — CID 44561691
ethyl 2-[[4-(benzenesulfonyl)-5-oxido-1,2,5-oxadiazol-5-ium-3-yl]oxy]acetate (PubChem CID 44561691) has the molecular formula C12H12N2O7S and a molecular weight of 328.30 g/mol. Its IUPAC name is ethyl 2-[[4-(benzenesulfonyl)-5-oxido-1,2,5-oxadiazol-5-ium-3-yl]oxy]acetate.
| Compound Name | ethyl 2-[[4-(benzenesulfonyl)-5-oxido-1,2,5-oxadiazol-5-ium-3-yl]oxy]acetate |
|---|---|
| PubChem CID | 44561691 |
| Molecular Formula | C12H12N2O7S |
| Molecular Weight | 328.30 g/mol |
| Exact Mass | 328.04 |
| IUPAC Name | ethyl 2-[[4-(benzenesulfonyl)-5-oxido-1,2,5-oxadiazol-5-ium-3-yl]oxy]acetate |
| SMILES | CCOC(=O)COc1no[n+]([O-])c1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C12H12N2O7S/c1-2-19-10(15)8-20-11-12(14(16)21-13-11)22(17,18)9-6-4-3-5-7-9/h3-7H,2,8H2,1H3 |
| InChIKey | ASRJZRGZIQFWTE-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 122.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.30 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'} |
|---|