C26H25N3O10S — CID 175440940
4-[[4-(benzenesulfonyl)-5-oxido-1,2,5-oxadiazol-5-ium-3-yl]oxy]but-2-ynyl 3-[4-[5-(hydroxyamino)-5-oxopentoxy]phenyl]prop-2-enoate (PubChem CID 175440940) has the molecular formula C26H25N3O10S and a molecular weight of 571.56 g/mol. Its IUPAC name is 4-[[4-(benzenesulfonyl)-5-oxido-1,2,5-oxadiazol-5-ium-3-yl]oxy]but-2-ynyl 3-[4-[5-(hydroxyamino)-5-oxopentoxy]phenyl]prop-2-enoate.
| Compound Name | 4-[[4-(benzenesulfonyl)-5-oxido-1,2,5-oxadiazol-5-ium-3-yl]oxy]but-2-ynyl 3-[4-[5-(hydroxyamino)-5-oxopentoxy]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 175440940 |
| Molecular Formula | C26H25N3O10S |
| Molecular Weight | 571.56 g/mol |
| Exact Mass | 571.13 |
| IUPAC Name | 4-[[4-(benzenesulfonyl)-5-oxido-1,2,5-oxadiazol-5-ium-3-yl]oxy]but-2-ynyl 3-[4-[5-(hydroxyamino)-5-oxopentoxy]phenyl]prop-2-enoate |
| SMILES | O=C(CCCCOc1ccc(C=CC(=O)OCC#CCOc2no[n+]([O-])c2S(=O)(=O)c2ccccc2)cc1)NO |
| InChI | InChI=1S/C26H25N3O10S/c30-23(27-32)10-4-5-17-36-21-14-11-20(12-15-21)13-16-24(31)37-18-6-7-19-38-25-26(29(33)39-28-25)40(34,35)22-8-2-1-3-9-22/h1-3,8-9,11-16,32H,4-5,10,17-19H2,(H,27,30) |
| InChIKey | QCFJMCNATVAZRS-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 181.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.56 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|