C35H36ClN7O8S — CID 169085054
7-[[4-(benzenesulfonyl)-5-oxido-1,2,5-oxadiazol-5-ium-3-yl]oxy]heptyl 2-[4-[[5-chloro-4-[2-(methylcarbamoyl)anilino]pyrimidin-2-yl]amino]phenyl]acetate (PubChem CID 169085054) has the molecular formula C35H36ClN7O8S and a molecular weight of 750.23 g/mol. Its IUPAC name is 7-[[4-(benzenesulfonyl)-5-oxido-1,2,5-oxadiazol-5-ium-3-yl]oxy]heptyl 2-[4-[[5-chloro-4-[2-(methylcarbamoyl)anilino]pyrimidin-2-yl]amino]phenyl]acetate.
| Compound Name | 7-[[4-(benzenesulfonyl)-5-oxido-1,2,5-oxadiazol-5-ium-3-yl]oxy]heptyl 2-[4-[[5-chloro-4-[2-(methylcarbamoyl)anilino]pyrimidin-2-yl]amino]phenyl]acetate |
|---|---|
| PubChem CID | 169085054 |
| Molecular Formula | C35H36ClN7O8S |
| Molecular Weight | 750.23 g/mol |
| Exact Mass | 749.20 |
| IUPAC Name | 7-[[4-(benzenesulfonyl)-5-oxido-1,2,5-oxadiazol-5-ium-3-yl]oxy]heptyl 2-[4-[[5-chloro-4-[2-(methylcarbamoyl)anilino]pyrimidin-2-yl]amino]phenyl]acetate |
| SMILES | CNC(=O)c1ccccc1Nc1nc(Nc2ccc(CC(=O)OCCCCCCCOc3no[n+]([O-])c3S(=O)(=O)c3ccccc3)cc2)ncc1Cl |
| InChI | InChI=1S/C35H36ClN7O8S/c1-37-32(45)27-14-8-9-15-29(27)40-31-28(36)23-38-35(41-31)39-25-18-16-24(17-19-25)22-30(44)49-20-10-3-2-4-11-21-50-33-34(43(46)51-42-33)52(47,48)26-12-6-5-7-13-26/h5-9,12-19,23H,2-4,10-11,20-22H2,1H3,(H,37,45)(H2,38,39,40,41) |
| InChIKey | FOTNQQHJEFJTBW-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 201.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 750.23 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'} |
|---|