C29H28N4O10S — CID 175440947
4-[[4-(benzenesulfonyl)-5-oxido-1,2,5-oxadiazol-5-ium-3-yl]oxy]but-2-ynyl 3-[3-cyano-4-[7-(hydroxyamino)-7-oxoheptoxy]phenyl]prop-2-enoate (PubChem CID 175440947) has the molecular formula C29H28N4O10S and a molecular weight of 624.63 g/mol. Its IUPAC name is 4-[[4-(benzenesulfonyl)-5-oxido-1,2,5-oxadiazol-5-ium-3-yl]oxy]but-2-ynyl 3-[3-cyano-4-[7-(hydroxyamino)-7-oxoheptoxy]phenyl]prop-2-enoate.
| Compound Name | 4-[[4-(benzenesulfonyl)-5-oxido-1,2,5-oxadiazol-5-ium-3-yl]oxy]but-2-ynyl 3-[3-cyano-4-[7-(hydroxyamino)-7-oxoheptoxy]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 175440947 |
| Molecular Formula | C29H28N4O10S |
| Molecular Weight | 624.63 g/mol |
| Exact Mass | 624.15 |
| IUPAC Name | 4-[[4-(benzenesulfonyl)-5-oxido-1,2,5-oxadiazol-5-ium-3-yl]oxy]but-2-ynyl 3-[3-cyano-4-[7-(hydroxyamino)-7-oxoheptoxy]phenyl]prop-2-enoate |
| SMILES | N#Cc1cc(C=CC(=O)OCC#CCOc2no[n+]([O-])c2S(=O)(=O)c2ccccc2)ccc1OCCCCCCC(=O)NO |
| InChI | InChI=1S/C29H28N4O10S/c30-21-23-20-22(13-15-25(23)40-17-7-2-1-6-12-26(34)31-36)14-16-27(35)41-18-8-9-19-42-28-29(33(37)43-32-28)44(38,39)24-10-4-3-5-11-24/h3-5,10-11,13-16,20,36H,1-2,6-7,12,17-19H2,(H,31,34) |
| InChIKey | HJPLDABZVIXPLV-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 204.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.63 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|