C30H44N4O7S — CID 86296454
3-[[4-(benzenesulfonyl)-5-oxido-1,2,5-oxadiazol-5-ium-3-yl]oxy]propyl 4-(7-butyl-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl)butanoate (PubChem CID 86296454) has the molecular formula C30H44N4O7S and a molecular weight of 604.77 g/mol. Its IUPAC name is 3-[[4-(benzenesulfonyl)-5-oxido-1,2,5-oxadiazol-5-ium-3-yl]oxy]propyl 4-(7-butyl-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl)butanoate.
| Compound Name | 3-[[4-(benzenesulfonyl)-5-oxido-1,2,5-oxadiazol-5-ium-3-yl]oxy]propyl 4-(7-butyl-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl)butanoate |
|---|---|
| PubChem CID | 86296454 |
| Molecular Formula | C30H44N4O7S |
| Molecular Weight | 604.77 g/mol |
| Exact Mass | 604.29 |
| IUPAC Name | 3-[[4-(benzenesulfonyl)-5-oxido-1,2,5-oxadiazol-5-ium-3-yl]oxy]propyl 4-(7-butyl-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl)butanoate |
| SMILES | CCCCN1CC2CCCN3CCCC(C1CCCC(=O)OCCCOc1no[n+]([O-])c1S(=O)(=O)c1ccccc1)C23 |
| InChI | InChI=1S/C30H44N4O7S/c1-2-3-17-33-22-23-11-8-18-32-19-9-14-25(28(23)32)26(33)15-7-16-27(35)39-20-10-21-40-29-30(34(36)41-31-29)42(37,38)24-12-5-4-6-13-24/h4-6,12-13,23,25-26,28H,2-3,7-11,14-22H2,1H3 |
| InChIKey | YITIZNCXLOFYAK-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 129.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.77 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'} |
|---|