C32H48N4O6S — CID 122233305
5-[[4-(benzenesulfonyl)-1,2,5-oxadiazol-3-yl]oxy]pentyl 4-[(5S,9R,13R)-7-butyl-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]butanoate (PubChem CID 122233305) has the molecular formula C32H48N4O6S and a molecular weight of 616.83 g/mol. Its IUPAC name is 5-[[4-(benzenesulfonyl)-1,2,5-oxadiazol-3-yl]oxy]pentyl 4-[(5S,9R,13R)-7-butyl-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]butanoate.
| Compound Name | 5-[[4-(benzenesulfonyl)-1,2,5-oxadiazol-3-yl]oxy]pentyl 4-[(5S,9R,13R)-7-butyl-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]butanoate |
|---|---|
| PubChem CID | 122233305 |
| Molecular Formula | C32H48N4O6S |
| Molecular Weight | 616.83 g/mol |
| Exact Mass | 616.33 |
| IUPAC Name | 5-[[4-(benzenesulfonyl)-1,2,5-oxadiazol-3-yl]oxy]pentyl 4-[(5S,9R,13R)-7-butyl-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]butanoate |
| SMILES | CCCCN1C[C@H]2CCCN3CCC[C@@H](C1CCCC(=O)OCCCCCOc1nonc1S(=O)(=O)c1ccccc1)[C@@H]23 |
| InChI | InChI=1S/C32H48N4O6S/c1-2-3-19-36-24-25-13-11-20-35-21-12-16-27(30(25)35)28(36)17-10-18-29(37)40-22-8-5-9-23-41-31-32(34-42-33-31)43(38,39)26-14-6-4-7-15-26/h4,6-7,14-15,25,27-28,30H,2-3,5,8-13,16-24H2,1H3/t25-,27+,28?,30-/m1/s1 |
| InChIKey | PHIPNQORCIGGEA-VIXHIESUSA-N |
| XLogP | 5.14 |
| TPSA | 115.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.83 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|