C36H47N5O8S — CID 86297835
5-[[4-(benzenesulfonyl)-5-oxido-1,2,5-oxadiazol-5-ium-3-yl]oxy]pentyl 2-[4-(7-phenyl-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl)butanoylamino]acetate (PubChem CID 86297835) has the molecular formula C36H47N5O8S and a molecular weight of 709.87 g/mol. Its IUPAC name is 5-[[4-(benzenesulfonyl)-5-oxido-1,2,5-oxadiazol-5-ium-3-yl]oxy]pentyl 2-[4-(7-phenyl-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl)butanoylamino]acetate.
| Compound Name | 5-[[4-(benzenesulfonyl)-5-oxido-1,2,5-oxadiazol-5-ium-3-yl]oxy]pentyl 2-[4-(7-phenyl-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl)butanoylamino]acetate |
|---|---|
| PubChem CID | 86297835 |
| Molecular Formula | C36H47N5O8S |
| Molecular Weight | 709.87 g/mol |
| Exact Mass | 709.31 |
| IUPAC Name | 5-[[4-(benzenesulfonyl)-5-oxido-1,2,5-oxadiazol-5-ium-3-yl]oxy]pentyl 2-[4-(7-phenyl-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl)butanoylamino]acetate |
| SMILES | O=C(CCCC1C2CCCN3CCCC(CN1c1ccccc1)C23)NCC(=O)OCCCCCOc1no[n+]([O-])c1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C36H47N5O8S/c42-32(20-10-19-31-30-18-12-22-39-21-11-13-27(34(30)39)26-40(31)28-14-4-1-5-15-28)37-25-33(43)47-23-8-3-9-24-48-35-36(41(44)49-38-35)50(45,46)29-16-6-2-7-17-29/h1-2,4-7,14-17,27,30-31,34H,3,8-13,18-26H2,(H,37,42) |
| InChIKey | UQHYDFDYAAXZFM-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 158.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.87 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'} |
|---|