C17H25NO4S — CID 118740784
9-(benzenesulfonyl)-5-(methoxymethyl)-3-oxa-9-azaspiro[5.5]undecane (PubChem CID 118740784) has the molecular formula C17H25NO4S and a molecular weight of 339.46 g/mol. Its IUPAC name is 9-(benzenesulfonyl)-5-(methoxymethyl)-3-oxa-9-azaspiro[5.5]undecane.
| Compound Name | 9-(benzenesulfonyl)-5-(methoxymethyl)-3-oxa-9-azaspiro[5.5]undecane |
|---|---|
| PubChem CID | 118740784 |
| Molecular Formula | C17H25NO4S |
| Molecular Weight | 339.46 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | 9-(benzenesulfonyl)-5-(methoxymethyl)-3-oxa-9-azaspiro[5.5]undecane |
| SMILES | COCC1COCCC12CCN(S(=O)(=O)c1ccccc1)CC2 |
| InChI | InChI=1S/C17H25NO4S/c1-21-13-15-14-22-12-9-17(15)7-10-18(11-8-17)23(19,20)16-5-3-2-4-6-16/h2-6,15H,7-14H2,1H3 |
| InChIKey | QQRRPAFFTNCDSR-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.46 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |