C20H28N2O4S — CID 139008193
N-[[1-(benzenesulfonyl)piperidin-4-yl]methyl]-6-oxaspiro[2.5]octane-2-carboxamide (PubChem CID 139008193) has the molecular formula C20H28N2O4S and a molecular weight of 392.52 g/mol. Its IUPAC name is N-[[1-(benzenesulfonyl)piperidin-4-yl]methyl]-6-oxaspiro[2.5]octane-2-carboxamide.
| Compound Name | N-[[1-(benzenesulfonyl)piperidin-4-yl]methyl]-6-oxaspiro[2.5]octane-2-carboxamide |
|---|---|
| PubChem CID | 139008193 |
| Molecular Formula | C20H28N2O4S |
| Molecular Weight | 392.52 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | N-[[1-(benzenesulfonyl)piperidin-4-yl]methyl]-6-oxaspiro[2.5]octane-2-carboxamide |
| SMILES | O=C(NCC1CCN(S(=O)(=O)c2ccccc2)CC1)C1CC12CCOCC2 |
| InChI | InChI=1S/C20H28N2O4S/c23-19(18-14-20(18)8-12-26-13-9-20)21-15-16-6-10-22(11-7-16)27(24,25)17-4-2-1-3-5-17/h1-5,16,18H,6-15H2,(H,21,23) |
| InChIKey | UBFDGOVIZRCNLA-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.52 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |