C12H23NO4S — CID 131650714
5-(methoxymethyl)-9-methylsulfonyl-3-oxa-9-azaspiro[5.5]undecane (PubChem CID 131650714) has the molecular formula C12H23NO4S and a molecular weight of 277.39 g/mol. Its IUPAC name is 5-(methoxymethyl)-9-methylsulfonyl-3-oxa-9-azaspiro[5.5]undecane.
| Compound Name | 5-(methoxymethyl)-9-methylsulfonyl-3-oxa-9-azaspiro[5.5]undecane |
|---|---|
| PubChem CID | 131650714 |
| Molecular Formula | C12H23NO4S |
| Molecular Weight | 277.39 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | 5-(methoxymethyl)-9-methylsulfonyl-3-oxa-9-azaspiro[5.5]undecane |
| SMILES | COCC1COCCC12CCN(S(C)(=O)=O)CC2 |
| InChI | InChI=1S/C12H23NO4S/c1-16-9-11-10-17-8-5-12(11)3-6-13(7-4-12)18(2,14)15/h11H,3-10H2,1-2H3 |
| InChIKey | UVXLKDWYEIEMFM-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.39 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |