C15H23N3O4S — CID 97475928
(5R)-9-methylsulfonyl-5-(pyrazin-2-yloxymethyl)-3-oxa-9-azaspiro[5.5]undecane (PubChem CID 97475928) has the molecular formula C15H23N3O4S and a molecular weight of 341.43 g/mol. Its IUPAC name is (5R)-9-methylsulfonyl-5-(pyrazin-2-yloxymethyl)-3-oxa-9-azaspiro[5.5]undecane.
| Compound Name | (5R)-9-methylsulfonyl-5-(pyrazin-2-yloxymethyl)-3-oxa-9-azaspiro[5.5]undecane |
|---|---|
| PubChem CID | 97475928 |
| Molecular Formula | C15H23N3O4S |
| Molecular Weight | 341.43 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | (5R)-9-methylsulfonyl-5-(pyrazin-2-yloxymethyl)-3-oxa-9-azaspiro[5.5]undecane |
| SMILES | CS(=O)(=O)N1CCC2(CCOC[C@@H]2COc2cnccn2)CC1 |
| InChI | InChI=1S/C15H23N3O4S/c1-23(19,20)18-7-2-15(3-8-18)4-9-21-11-13(15)12-22-14-10-16-5-6-17-14/h5-6,10,13H,2-4,7-9,11-12H2,1H3/t13-/m1/s1 |
| InChIKey | OKXUOUVIYUFHNT-CYBMUJFWSA-N |
| XLogP | 0.93 |
| TPSA | 81.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.43 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |