C20H20F4N6O3 — CID 118745312
9-[(4-fluorophenyl)methyl]-2-(1,2,4-triazol-1-ylmethyl)-6,7,8,10-tetrahydropyrimido[1,2-a][1,4]diazepin-4-one;2,2,2-trifluoroacetic acid (PubChem CID 118745312) has the molecular formula C20H20F4N6O3 and a molecular weight of 468.41 g/mol. Its IUPAC name is 9-[(4-fluorophenyl)methyl]-2-(1,2,4-triazol-1-ylmethyl)-6,7,8,10-tetrahydropyrimido[1,2-a][1,4]diazepin-4-one;2,2,2-trifluoroacetic acid.
| Compound Name | 9-[(4-fluorophenyl)methyl]-2-(1,2,4-triazol-1-ylmethyl)-6,7,8,10-tetrahydropyrimido[1,2-a][1,4]diazepin-4-one;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 118745312 |
| Molecular Formula | C20H20F4N6O3 |
| Molecular Weight | 468.41 g/mol |
| Exact Mass | 468.15 |
| IUPAC Name | 9-[(4-fluorophenyl)methyl]-2-(1,2,4-triazol-1-ylmethyl)-6,7,8,10-tetrahydropyrimido[1,2-a][1,4]diazepin-4-one;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=c1cc(Cn2cncn2)nc2n1CCCN(Cc1ccc(F)cc1)C2 |
| InChI | InChI=1S/C18H19FN6O.C2HF3O2/c19-15-4-2-14(3-5-15)9-23-6-1-7-25-17(11-23)22-16(8-18(25)26)10-24-13-20-12-21-24;3-2(4,5)1(6)7/h2-5,8,12-13H,1,6-7,9-11H2;(H,6,7) |
| InChIKey | HFCVHIGCFUDTSX-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 106.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.41 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |