C17H19F3N6O2S — CID 155848406
7-[(5-methylthiophen-2-yl)methyl]-2-(1,2,4-triazol-1-ylmethyl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazine;2,2,2-trifluoroacetic acid (PubChem CID 155848406) has the molecular formula C17H19F3N6O2S and a molecular weight of 428.44 g/mol. Its IUPAC name is 7-[(5-methylthiophen-2-yl)methyl]-2-(1,2,4-triazol-1-ylmethyl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazine;2,2,2-trifluoroacetic acid.
| Compound Name | 7-[(5-methylthiophen-2-yl)methyl]-2-(1,2,4-triazol-1-ylmethyl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155848406 |
| Molecular Formula | C17H19F3N6O2S |
| Molecular Weight | 428.44 g/mol |
| Exact Mass | 428.12 |
| IUPAC Name | 7-[(5-methylthiophen-2-yl)methyl]-2-(1,2,4-triazol-1-ylmethyl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazine;2,2,2-trifluoroacetic acid |
| SMILES | Cc1ccc(CN2CCn3cc(Cn4cncn4)nc3C2)s1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C15H18N6S.C2HF3O2/c1-12-2-3-14(22-12)8-19-4-5-20-6-13(18-15(20)9-19)7-21-11-16-10-17-21;3-2(4,5)1(6)7/h2-3,6,10-11H,4-5,7-9H2,1H3;(H,6,7) |
| InChIKey | HIHDYQHCAVOWFY-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 89.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.44 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |