C16H18N6OS — CID 97382266
9-(thiophen-3-ylmethyl)-2-(1,2,4-triazol-1-ylmethyl)-6,7,8,10-tetrahydropyrimido[1,2-a][1,4]diazepin-4-one (PubChem CID 97382266) has the molecular formula C16H18N6OS and a molecular weight of 342.43 g/mol. Its IUPAC name is 9-(thiophen-3-ylmethyl)-2-(1,2,4-triazol-1-ylmethyl)-6,7,8,10-tetrahydropyrimido[1,2-a][1,4]diazepin-4-one.
| Compound Name | 9-(thiophen-3-ylmethyl)-2-(1,2,4-triazol-1-ylmethyl)-6,7,8,10-tetrahydropyrimido[1,2-a][1,4]diazepin-4-one |
|---|---|
| PubChem CID | 97382266 |
| Molecular Formula | C16H18N6OS |
| Molecular Weight | 342.43 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | 9-(thiophen-3-ylmethyl)-2-(1,2,4-triazol-1-ylmethyl)-6,7,8,10-tetrahydropyrimido[1,2-a][1,4]diazepin-4-one |
| SMILES | O=c1cc(Cn2cncn2)nc2n1CCCN(Cc1ccsc1)C2 |
| InChI | InChI=1S/C16H18N6OS/c23-16-6-14(8-21-12-17-11-18-21)19-15-9-20(3-1-4-22(15)16)7-13-2-5-24-10-13/h2,5-6,10-12H,1,3-4,7-9H2 |
| InChIKey | FJKJBWJPVIGDQU-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 68.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.43 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |