C20H23F3N4O4S — CID 118744635
N-[[9-(cyclopropylmethyl)-4-oxo-6,7,8,10-tetrahydropyrimido[1,2-a][1,4]diazepin-2-yl]methyl]thiophene-3-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 118744635) has the molecular formula C20H23F3N4O4S and a molecular weight of 472.49 g/mol. Its IUPAC name is N-[[9-(cyclopropylmethyl)-4-oxo-6,7,8,10-tetrahydropyrimido[1,2-a][1,4]diazepin-2-yl]methyl]thiophene-3-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-[[9-(cyclopropylmethyl)-4-oxo-6,7,8,10-tetrahydropyrimido[1,2-a][1,4]diazepin-2-yl]methyl]thiophene-3-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 118744635 |
| Molecular Formula | C20H23F3N4O4S |
| Molecular Weight | 472.49 g/mol |
| Exact Mass | 472.14 |
| IUPAC Name | N-[[9-(cyclopropylmethyl)-4-oxo-6,7,8,10-tetrahydropyrimido[1,2-a][1,4]diazepin-2-yl]methyl]thiophene-3-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | O=C(NCc1cc(=O)n2c(n1)CN(CC1CC1)CCC2)c1ccsc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H22N4O2S.C2HF3O2/c23-17-8-15(9-19-18(24)14-4-7-25-12-14)20-16-11-21(10-13-2-3-13)5-1-6-22(16)17;3-2(4,5)1(6)7/h4,7-8,12-13H,1-3,5-6,9-11H2,(H,19,24);(H,6,7) |
| InChIKey | HAHRETPXVMKJOO-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.49 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |