C23H27F6N3O5S — CID 118745725
7-(cyclobutylmethyl)-1-[(2-methyl-1,3-thiazol-4-yl)methyl]-5,6,8,9-tetrahydropyrido[2,3-d]azepin-2-one;bis(2,2,2-trifluoroacetic acid) (PubChem CID 118745725) has the molecular formula C23H27F6N3O5S and a molecular weight of 571.54 g/mol. Its IUPAC name is 7-(cyclobutylmethyl)-1-[(2-methyl-1,3-thiazol-4-yl)methyl]-5,6,8,9-tetrahydropyrido[2,3-d]azepin-2-one;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 7-(cyclobutylmethyl)-1-[(2-methyl-1,3-thiazol-4-yl)methyl]-5,6,8,9-tetrahydropyrido[2,3-d]azepin-2-one;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 118745725 |
| Molecular Formula | C23H27F6N3O5S |
| Molecular Weight | 571.54 g/mol |
| Exact Mass | 571.16 |
| IUPAC Name | 7-(cyclobutylmethyl)-1-[(2-methyl-1,3-thiazol-4-yl)methyl]-5,6,8,9-tetrahydropyrido[2,3-d]azepin-2-one;bis(2,2,2-trifluoroacetic acid) |
| SMILES | Cc1nc(Cn2c3c(ccc2=O)CCN(CC2CCC2)CC3)cs1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C19H25N3OS.2C2HF3O2/c1-14-20-17(13-24-14)12-22-18-8-10-21(11-15-3-2-4-15)9-7-16(18)5-6-19(22)23;2*3-2(4,5)1(6)7/h5-6,13,15H,2-4,7-12H2,1H3;2*(H,6,7) |
| InChIKey | JKKLETBXGKBYEV-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 112.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.54 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |