C26H32F3N3O3S — CID 155864716
9-(2,3-dihydro-1H-inden-5-ylmethyl)-1-[(2-methyl-1,3-thiazol-4-yl)methyl]-1,9-diazaspiro[4.6]undecan-2-one;2,2,2-trifluoroacetic acid (PubChem CID 155864716) has the molecular formula C26H32F3N3O3S and a molecular weight of 523.62 g/mol. Its IUPAC name is 9-(2,3-dihydro-1H-inden-5-ylmethyl)-1-[(2-methyl-1,3-thiazol-4-yl)methyl]-1,9-diazaspiro[4.6]undecan-2-one;2,2,2-trifluoroacetic acid.
| Compound Name | 9-(2,3-dihydro-1H-inden-5-ylmethyl)-1-[(2-methyl-1,3-thiazol-4-yl)methyl]-1,9-diazaspiro[4.6]undecan-2-one;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155864716 |
| Molecular Formula | C26H32F3N3O3S |
| Molecular Weight | 523.62 g/mol |
| Exact Mass | 523.21 |
| IUPAC Name | 9-(2,3-dihydro-1H-inden-5-ylmethyl)-1-[(2-methyl-1,3-thiazol-4-yl)methyl]-1,9-diazaspiro[4.6]undecan-2-one;2,2,2-trifluoroacetic acid |
| SMILES | Cc1nc(CN2C(=O)CCC23CCCN(Cc2ccc4c(c2)CCC4)CC3)cs1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C24H31N3OS.C2HF3O2/c1-18-25-22(17-29-18)16-27-23(28)8-10-24(27)9-3-12-26(13-11-24)15-19-6-7-20-4-2-5-21(20)14-19;3-2(4,5)1(6)7/h6-7,14,17H,2-5,8-13,15-16H2,1H3;(H,6,7) |
| InChIKey | WUJKUFUGSSCALU-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 73.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.62 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |