C20H29F6N5O5 — CID 118745937
7-ethyl-N,N,3-trimethylspiro[5,6-dihydroimidazo[1,2-a]pyrazine-8,4'-piperidine]-1'-carboxamide;bis(2,2,2-trifluoroacetic acid) (PubChem CID 118745937) has the molecular formula C20H29F6N5O5 and a molecular weight of 533.47 g/mol. Its IUPAC name is 7-ethyl-N,N,3-trimethylspiro[5,6-dihydroimidazo[1,2-a]pyrazine-8,4'-piperidine]-1'-carboxamide;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 7-ethyl-N,N,3-trimethylspiro[5,6-dihydroimidazo[1,2-a]pyrazine-8,4'-piperidine]-1'-carboxamide;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 118745937 |
| Molecular Formula | C20H29F6N5O5 |
| Molecular Weight | 533.47 g/mol |
| Exact Mass | 533.21 |
| IUPAC Name | 7-ethyl-N,N,3-trimethylspiro[5,6-dihydroimidazo[1,2-a]pyrazine-8,4'-piperidine]-1'-carboxamide;bis(2,2,2-trifluoroacetic acid) |
| SMILES | CCN1CCn2c(C)cnc2C12CCN(C(=O)N(C)C)CC2.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C16H27N5O.2C2HF3O2/c1-5-20-10-11-21-13(2)12-17-14(21)16(20)6-8-19(9-7-16)15(22)18(3)4;2*3-2(4,5)1(6)7/h12H,5-11H2,1-4H3;2*(H,6,7) |
| InChIKey | WDUYNPBUCGSZKL-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 119.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.47 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |