C20H33NO4 — CID 11874670
(3S,3aR,4aS,8aR,9aR)-3-[[2,2-dimethoxyethyl(methyl)amino]methyl]-8a-methyl-5-methylidene-3a,4,4a,6,7,8,9,9a-octahydro-3H-benzo[f][1]benzofuran-2-one (PubChem CID 11874670) has the molecular formula C20H33NO4 and a molecular weight of 351.49 g/mol. Its IUPAC name is (3S,3aR,4aS,8aR,9aR)-3-[[2,2-dimethoxyethyl(methyl)amino]methyl]-8a-methyl-5-methylidene-3a,4,4a,6,7,8,9,9a-octahydro-3H-benzo[f][1]benzofuran-2-one.
| Compound Name | (3S,3aR,4aS,8aR,9aR)-3-[[2,2-dimethoxyethyl(methyl)amino]methyl]-8a-methyl-5-methylidene-3a,4,4a,6,7,8,9,9a-octahydro-3H-benzo[f][1]benzofuran-2-one |
|---|---|
| PubChem CID | 11874670 |
| Molecular Formula | C20H33NO4 |
| Molecular Weight | 351.49 g/mol |
| Exact Mass | 351.24 |
| IUPAC Name | (3S,3aR,4aS,8aR,9aR)-3-[[2,2-dimethoxyethyl(methyl)amino]methyl]-8a-methyl-5-methylidene-3a,4,4a,6,7,8,9,9a-octahydro-3H-benzo[f][1]benzofuran-2-one |
| SMILES | C=C1CCC[C@]2(C)C[C@H]3OC(=O)[C@H](CN(C)CC(OC)OC)[C@H]3C[C@@H]12 |
| InChI | InChI=1S/C20H33NO4/c1-13-7-6-8-20(2)10-17-14(9-16(13)20)15(19(22)25-17)11-21(3)12-18(23-4)24-5/h14-18H,1,6-12H2,2-5H3/t14-,15-,16+,17-,20-/m1/s1 |
| InChIKey | YHZOBPBMQMCRTE-ISIBIEBGSA-N |
| XLogP | 2.85 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.49 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|