C22H37NO7 — CID 99975640
(3S,3aR,4aS,8aR,9aR)-8a-methyl-5-methylidene-3-[[methyl-[(2R,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]amino]methyl]-3a,4,4a,6,7,8,9,9a-octahydro-3H-benzo[f][1]benzofuran-2-one (PubChem CID 99975640) has the molecular formula C22H37NO7 and a molecular weight of 427.54 g/mol. Its IUPAC name is (3S,3aR,4aS,8aR,9aR)-8a-methyl-5-methylidene-3-[[methyl-[(2R,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]amino]methyl]-3a,4,4a,6,7,8,9,9a-octahydro-3H-benzo[f][1]benzofuran-2-one.
| Compound Name | (3S,3aR,4aS,8aR,9aR)-8a-methyl-5-methylidene-3-[[methyl-[(2R,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]amino]methyl]-3a,4,4a,6,7,8,9,9a-octahydro-3H-benzo[f][1]benzofuran-2-one |
|---|---|
| PubChem CID | 99975640 |
| Molecular Formula | C22H37NO7 |
| Molecular Weight | 427.54 g/mol |
| Exact Mass | 427.26 |
| IUPAC Name | (3S,3aR,4aS,8aR,9aR)-8a-methyl-5-methylidene-3-[[methyl-[(2R,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]amino]methyl]-3a,4,4a,6,7,8,9,9a-octahydro-3H-benzo[f][1]benzofuran-2-one |
| SMILES | C=C1CCC[C@]2(C)C[C@H]3OC(=O)[C@H](CN(C)C[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO)[C@H]3C[C@@H]12 |
| InChI | InChI=1S/C22H37NO7/c1-12-5-4-6-22(2)8-18-13(7-15(12)22)14(21(29)30-18)9-23(3)10-16(25)19(27)20(28)17(26)11-24/h13-20,24-28H,1,4-11H2,2-3H3/t13-,14-,15+,16-,17-,18-,19-,20-,22-/m1/s1 |
| InChIKey | OLTZZXRGVSYTGW-MSPAGHCUSA-N |
| XLogP | -0.33 |
| TPSA | 130.69 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.54 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|