C27H28N4O5 — CID 118754277
3-(1,3-benzodioxol-5-ylmethyl)-5-ethyl-5-[1-(1H-indole-6-carbonyl)piperidin-4-yl]imidazolidine-2,4-dione (PubChem CID 118754277) has the molecular formula C27H28N4O5 and a molecular weight of 488.54 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-ylmethyl)-5-ethyl-5-[1-(1H-indole-6-carbonyl)piperidin-4-yl]imidazolidine-2,4-dione.
| Compound Name | 3-(1,3-benzodioxol-5-ylmethyl)-5-ethyl-5-[1-(1H-indole-6-carbonyl)piperidin-4-yl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 118754277 |
| Molecular Formula | C27H28N4O5 |
| Molecular Weight | 488.54 g/mol |
| Exact Mass | 488.21 |
| IUPAC Name | 3-(1,3-benzodioxol-5-ylmethyl)-5-ethyl-5-[1-(1H-indole-6-carbonyl)piperidin-4-yl]imidazolidine-2,4-dione |
| SMILES | CCC1(C2CCN(C(=O)c3ccc4cc[nH]c4c3)CC2)NC(=O)N(Cc2ccc3c(c2)OCO3)C1=O |
| InChI | InChI=1S/C27H28N4O5/c1-2-27(25(33)31(26(34)29-27)15-17-3-6-22-23(13-17)36-16-35-22)20-8-11-30(12-9-20)24(32)19-5-4-18-7-10-28-21(18)14-19/h3-7,10,13-14,20,28H,2,8-9,11-12,15-16H2,1H3,(H,29,34) |
| InChIKey | XFJHJMSIQBZLLB-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 103.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.54 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|