C25H33N3O4 — CID 26277997
(5S)-3-(1,3-benzodioxol-5-ylmethyl)-5-[1-[[(1R)-cyclohex-3-en-1-yl]methyl]piperidin-4-yl]-5-ethylimidazolidine-2,4-dione (PubChem CID 26277997) has the molecular formula C25H33N3O4 and a molecular weight of 439.56 g/mol. Its IUPAC name is (5S)-3-(1,3-benzodioxol-5-ylmethyl)-5-[1-[[(1R)-cyclohex-3-en-1-yl]methyl]piperidin-4-yl]-5-ethylimidazolidine-2,4-dione.
| Compound Name | (5S)-3-(1,3-benzodioxol-5-ylmethyl)-5-[1-[[(1R)-cyclohex-3-en-1-yl]methyl]piperidin-4-yl]-5-ethylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 26277997 |
| Molecular Formula | C25H33N3O4 |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.25 |
| IUPAC Name | (5S)-3-(1,3-benzodioxol-5-ylmethyl)-5-[1-[[(1R)-cyclohex-3-en-1-yl]methyl]piperidin-4-yl]-5-ethylimidazolidine-2,4-dione |
| SMILES | CC[C@@]1(C2CCN(C[C@H]3CC=CCC3)CC2)NC(=O)N(Cc2ccc3c(c2)OCO3)C1=O |
| InChI | InChI=1S/C25H33N3O4/c1-2-25(20-10-12-27(13-11-20)15-18-6-4-3-5-7-18)23(29)28(24(30)26-25)16-19-8-9-21-22(14-19)32-17-31-21/h3-4,8-9,14,18,20H,2,5-7,10-13,15-17H2,1H3,(H,26,30)/t18-,25-/m0/s1 |
| InChIKey | KJLWIQOLCVPEOJ-BVZFJXPGSA-N |
| XLogP | 3.68 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|