C26H28FN3O5 — CID 26279424
(5S)-3-(1,3-benzodioxol-5-ylmethyl)-5-ethyl-5-[1-[2-(4-fluorophenyl)acetyl]piperidin-4-yl]imidazolidine-2,4-dione (PubChem CID 26279424) has the molecular formula C26H28FN3O5 and a molecular weight of 481.52 g/mol. Its IUPAC name is (5S)-3-(1,3-benzodioxol-5-ylmethyl)-5-ethyl-5-[1-[2-(4-fluorophenyl)acetyl]piperidin-4-yl]imidazolidine-2,4-dione.
| Compound Name | (5S)-3-(1,3-benzodioxol-5-ylmethyl)-5-ethyl-5-[1-[2-(4-fluorophenyl)acetyl]piperidin-4-yl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 26279424 |
| Molecular Formula | C26H28FN3O5 |
| Molecular Weight | 481.52 g/mol |
| Exact Mass | 481.20 |
| IUPAC Name | (5S)-3-(1,3-benzodioxol-5-ylmethyl)-5-ethyl-5-[1-[2-(4-fluorophenyl)acetyl]piperidin-4-yl]imidazolidine-2,4-dione |
| SMILES | CC[C@@]1(C2CCN(C(=O)Cc3ccc(F)cc3)CC2)NC(=O)N(Cc2ccc3c(c2)OCO3)C1=O |
| InChI | InChI=1S/C26H28FN3O5/c1-2-26(19-9-11-29(12-10-19)23(31)14-17-3-6-20(27)7-4-17)24(32)30(25(33)28-26)15-18-5-8-21-22(13-18)35-16-34-21/h3-8,13,19H,2,9-12,14-16H2,1H3,(H,28,33)/t26-/m0/s1 |
| InChIKey | DKSSGUMQKHVZOM-SANMLTNESA-N |
| XLogP | 3.24 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.52 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|