C27H39FN4O2 — CID 26276690
(5S)-5-[1-[[(1R)-cyclohex-3-en-1-yl]methyl]piperidin-4-yl]-3-[3-(dimethylamino)propyl]-5-[(4-fluorophenyl)methyl]imidazolidine-2,4-dione (PubChem CID 26276690) has the molecular formula C27H39FN4O2 and a molecular weight of 470.63 g/mol. Its IUPAC name is (5S)-5-[1-[[(1R)-cyclohex-3-en-1-yl]methyl]piperidin-4-yl]-3-[3-(dimethylamino)propyl]-5-[(4-fluorophenyl)methyl]imidazolidine-2,4-dione.
| Compound Name | (5S)-5-[1-[[(1R)-cyclohex-3-en-1-yl]methyl]piperidin-4-yl]-3-[3-(dimethylamino)propyl]-5-[(4-fluorophenyl)methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 26276690 |
| Molecular Formula | C27H39FN4O2 |
| Molecular Weight | 470.63 g/mol |
| Exact Mass | 470.31 |
| IUPAC Name | (5S)-5-[1-[[(1R)-cyclohex-3-en-1-yl]methyl]piperidin-4-yl]-3-[3-(dimethylamino)propyl]-5-[(4-fluorophenyl)methyl]imidazolidine-2,4-dione |
| SMILES | CN(C)CCCN1C(=O)N[C@@](Cc2ccc(F)cc2)(C2CCN(C[C@H]3CC=CCC3)CC2)C1=O |
| InChI | InChI=1S/C27H39FN4O2/c1-30(2)15-6-16-32-25(33)27(29-26(32)34,19-21-9-11-24(28)12-10-21)23-13-17-31(18-14-23)20-22-7-4-3-5-8-22/h3-4,9-12,22-23H,5-8,13-20H2,1-2H3,(H,29,34)/t22-,27-/m0/s1 |
| InChIKey | KLCRAOSWHXLPOJ-CUNXSJBXSA-N |
| XLogP | 3.68 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.63 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|