C24H26FN3O4 — CID 118755903
5-[(3-fluorophenyl)methyl]-7-[(2-morpholin-4-ylethylamino)methyl]-[1,3]dioxolo[4,5-g]quinolin-6-one (PubChem CID 118755903) has the molecular formula C24H26FN3O4 and a molecular weight of 439.49 g/mol. Its IUPAC name is 5-[(3-fluorophenyl)methyl]-7-[(2-morpholin-4-ylethylamino)methyl]-[1,3]dioxolo[4,5-g]quinolin-6-one.
| Compound Name | 5-[(3-fluorophenyl)methyl]-7-[(2-morpholin-4-ylethylamino)methyl]-[1,3]dioxolo[4,5-g]quinolin-6-one |
|---|---|
| PubChem CID | 118755903 |
| Molecular Formula | C24H26FN3O4 |
| Molecular Weight | 439.49 g/mol |
| Exact Mass | 439.19 |
| IUPAC Name | 5-[(3-fluorophenyl)methyl]-7-[(2-morpholin-4-ylethylamino)methyl]-[1,3]dioxolo[4,5-g]quinolin-6-one |
| SMILES | O=c1c(CNCCN2CCOCC2)cc2cc3c(cc2n1Cc1cccc(F)c1)OCO3 |
| InChI | InChI=1S/C24H26FN3O4/c25-20-3-1-2-17(10-20)15-28-21-13-23-22(31-16-32-23)12-18(21)11-19(24(28)29)14-26-4-5-27-6-8-30-9-7-27/h1-3,10-13,26H,4-9,14-16H2 |
| InChIKey | PPEWPKSOLUEDFK-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 64.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.49 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|