C25H29N3O3S — CID 118757676
1-phenyl-2-[2-[4-(thiophen-2-ylmethyl)piperazine-1-carbonyl]-6-azaspiro[2.5]octan-6-yl]ethane-1,2-dione (PubChem CID 118757676) has the molecular formula C25H29N3O3S and a molecular weight of 451.59 g/mol. Its IUPAC name is 1-phenyl-2-[2-[4-(thiophen-2-ylmethyl)piperazine-1-carbonyl]-6-azaspiro[2.5]octan-6-yl]ethane-1,2-dione.
| Compound Name | 1-phenyl-2-[2-[4-(thiophen-2-ylmethyl)piperazine-1-carbonyl]-6-azaspiro[2.5]octan-6-yl]ethane-1,2-dione |
|---|---|
| PubChem CID | 118757676 |
| Molecular Formula | C25H29N3O3S |
| Molecular Weight | 451.59 g/mol |
| Exact Mass | 451.19 |
| IUPAC Name | 1-phenyl-2-[2-[4-(thiophen-2-ylmethyl)piperazine-1-carbonyl]-6-azaspiro[2.5]octan-6-yl]ethane-1,2-dione |
| SMILES | O=C(C(=O)N1CCC2(CC1)CC2C(=O)N1CCN(Cc2cccs2)CC1)c1ccccc1 |
| InChI | InChI=1S/C25H29N3O3S/c29-22(19-5-2-1-3-6-19)24(31)27-10-8-25(9-11-27)17-21(25)23(30)28-14-12-26(13-15-28)18-20-7-4-16-32-20/h1-7,16,21H,8-15,17-18H2 |
| InChIKey | WCLQPTLGODSACX-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.59 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|