C23H24N2O5 — CID 118757948
methyl 4-[[4-(2-acetylbenzoyl)-7-oxo-1,4-diazepan-1-yl]methyl]benzoate (PubChem CID 118757948) has the molecular formula C23H24N2O5 and a molecular weight of 408.45 g/mol. Its IUPAC name is methyl 4-[[4-(2-acetylbenzoyl)-7-oxo-1,4-diazepan-1-yl]methyl]benzoate.
| Compound Name | methyl 4-[[4-(2-acetylbenzoyl)-7-oxo-1,4-diazepan-1-yl]methyl]benzoate |
|---|---|
| PubChem CID | 118757948 |
| Molecular Formula | C23H24N2O5 |
| Molecular Weight | 408.45 g/mol |
| Exact Mass | 408.17 |
| IUPAC Name | methyl 4-[[4-(2-acetylbenzoyl)-7-oxo-1,4-diazepan-1-yl]methyl]benzoate |
| SMILES | COC(=O)c1ccc(CN2CCN(C(=O)c3ccccc3C(C)=O)CCC2=O)cc1 |
| InChI | InChI=1S/C23H24N2O5/c1-16(26)19-5-3-4-6-20(19)22(28)24-12-11-21(27)25(14-13-24)15-17-7-9-18(10-8-17)23(29)30-2/h3-10H,11-15H2,1-2H3 |
| InChIKey | XOZPPNXRVMSPLE-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.45 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |