C21H21N5O2 — CID 118758520
ethyl 1-(1H-benzimidazol-2-yl)-5-[(benzylamino)methyl]pyrazole-4-carboxylate (PubChem CID 118758520) has the molecular formula C21H21N5O2 and a molecular weight of 375.43 g/mol. Its IUPAC name is ethyl 1-(1H-benzimidazol-2-yl)-5-[(benzylamino)methyl]pyrazole-4-carboxylate.
| Compound Name | ethyl 1-(1H-benzimidazol-2-yl)-5-[(benzylamino)methyl]pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 118758520 |
| Molecular Formula | C21H21N5O2 |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.17 |
| IUPAC Name | ethyl 1-(1H-benzimidazol-2-yl)-5-[(benzylamino)methyl]pyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cnn(-c2nc3ccccc3[nH]2)c1CNCc1ccccc1 |
| InChI | InChI=1S/C21H21N5O2/c1-2-28-20(27)16-13-23-26(21-24-17-10-6-7-11-18(17)25-21)19(16)14-22-12-15-8-4-3-5-9-15/h3-11,13,22H,2,12,14H2,1H3,(H,24,25) |
| InChIKey | SNNZAAIQQPLNIF-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 84.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |