C21H19N5O3 — CID 46403197
ethyl 1-[4-(1H-benzimidazol-2-ylcarbamoyl)phenyl]-5-methylpyrazole-4-carboxylate (PubChem CID 46403197) has the molecular formula C21H19N5O3 and a molecular weight of 389.42 g/mol. Its IUPAC name is ethyl 1-[4-(1H-benzimidazol-2-ylcarbamoyl)phenyl]-5-methylpyrazole-4-carboxylate.
| Compound Name | ethyl 1-[4-(1H-benzimidazol-2-ylcarbamoyl)phenyl]-5-methylpyrazole-4-carboxylate |
|---|---|
| PubChem CID | 46403197 |
| Molecular Formula | C21H19N5O3 |
| Molecular Weight | 389.42 g/mol |
| Exact Mass | 389.15 |
| IUPAC Name | ethyl 1-[4-(1H-benzimidazol-2-ylcarbamoyl)phenyl]-5-methylpyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cnn(-c2ccc(C(=O)Nc3nc4ccccc4[nH]3)cc2)c1C |
| InChI | InChI=1S/C21H19N5O3/c1-3-29-20(28)16-12-22-26(13(16)2)15-10-8-14(9-11-15)19(27)25-21-23-17-6-4-5-7-18(17)24-21/h4-12H,3H2,1-2H3,(H2,23,24,25,27) |
| InChIKey | KVTOFMKNARHYQA-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 101.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.42 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |