C26H25N3O3S — CID 118759264
2-[4-(1-benzothiophen-3-yl)-2-[(4-pyridin-2-ylpiperazin-1-yl)methyl]phenoxy]acetic acid (PubChem CID 118759264) has the molecular formula C26H25N3O3S and a molecular weight of 459.57 g/mol. Its IUPAC name is 2-[4-(1-benzothiophen-3-yl)-2-[(4-pyridin-2-ylpiperazin-1-yl)methyl]phenoxy]acetic acid.
| Compound Name | 2-[4-(1-benzothiophen-3-yl)-2-[(4-pyridin-2-ylpiperazin-1-yl)methyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 118759264 |
| Molecular Formula | C26H25N3O3S |
| Molecular Weight | 459.57 g/mol |
| Exact Mass | 459.16 |
| IUPAC Name | 2-[4-(1-benzothiophen-3-yl)-2-[(4-pyridin-2-ylpiperazin-1-yl)methyl]phenoxy]acetic acid |
| SMILES | O=C(O)COc1ccc(-c2csc3ccccc23)cc1CN1CCN(c2ccccn2)CC1 |
| InChI | InChI=1S/C26H25N3O3S/c30-26(31)17-32-23-9-8-19(22-18-33-24-6-2-1-5-21(22)24)15-20(23)16-28-11-13-29(14-12-28)25-7-3-4-10-27-25/h1-10,15,18H,11-14,16-17H2,(H,30,31) |
| InChIKey | KSBLHLJMFDFPJI-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 65.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.57 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |