C27H28FN3O3 — CID 118760570
3-[(4-fluorophenyl)methyl]-5-[1-[[2-(furan-2-yl)phenyl]methyl]piperidin-4-yl]-5-methylimidazolidine-2,4-dione (PubChem CID 118760570) has the molecular formula C27H28FN3O3 and a molecular weight of 461.54 g/mol. Its IUPAC name is 3-[(4-fluorophenyl)methyl]-5-[1-[[2-(furan-2-yl)phenyl]methyl]piperidin-4-yl]-5-methylimidazolidine-2,4-dione.
| Compound Name | 3-[(4-fluorophenyl)methyl]-5-[1-[[2-(furan-2-yl)phenyl]methyl]piperidin-4-yl]-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 118760570 |
| Molecular Formula | C27H28FN3O3 |
| Molecular Weight | 461.54 g/mol |
| Exact Mass | 461.21 |
| IUPAC Name | 3-[(4-fluorophenyl)methyl]-5-[1-[[2-(furan-2-yl)phenyl]methyl]piperidin-4-yl]-5-methylimidazolidine-2,4-dione |
| SMILES | CC1(C2CCN(Cc3ccccc3-c3ccco3)CC2)NC(=O)N(Cc2ccc(F)cc2)C1=O |
| InChI | InChI=1S/C27H28FN3O3/c1-27(25(32)31(26(33)29-27)17-19-8-10-22(28)11-9-19)21-12-14-30(15-13-21)18-20-5-2-3-6-23(20)24-7-4-16-34-24/h2-11,16,21H,12-15,17-18H2,1H3,(H,29,33) |
| InChIKey | QXGLTALKAYFCOP-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 65.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.54 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|