C22H27N3O3S — CID 45182819
5-[1-[(2-methoxyphenyl)methyl]piperidin-4-yl]-5-methyl-3-(thiophen-3-ylmethyl)imidazolidine-2,4-dione (PubChem CID 45182819) has the molecular formula C22H27N3O3S and a molecular weight of 413.54 g/mol. Its IUPAC name is 5-[1-[(2-methoxyphenyl)methyl]piperidin-4-yl]-5-methyl-3-(thiophen-3-ylmethyl)imidazolidine-2,4-dione.
| Compound Name | 5-[1-[(2-methoxyphenyl)methyl]piperidin-4-yl]-5-methyl-3-(thiophen-3-ylmethyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 45182819 |
| Molecular Formula | C22H27N3O3S |
| Molecular Weight | 413.54 g/mol |
| Exact Mass | 413.18 |
| IUPAC Name | 5-[1-[(2-methoxyphenyl)methyl]piperidin-4-yl]-5-methyl-3-(thiophen-3-ylmethyl)imidazolidine-2,4-dione |
| SMILES | COc1ccccc1CN1CCC(C2(C)NC(=O)N(Cc3ccsc3)C2=O)CC1 |
| InChI | InChI=1S/C22H27N3O3S/c1-22(20(26)25(21(27)23-22)13-16-9-12-29-15-16)18-7-10-24(11-8-18)14-17-5-3-4-6-19(17)28-2/h3-6,9,12,15,18H,7-8,10-11,13-14H2,1-2H3,(H,23,27) |
| InChIKey | WJXXIXJHUSEQPM-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.54 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|