C24H29N3O3S — CID 45183515
5-methyl-5-[1-(4-phenylbutanoyl)piperidin-4-yl]-3-(thiophen-3-ylmethyl)imidazolidine-2,4-dione (PubChem CID 45183515) has the molecular formula C24H29N3O3S and a molecular weight of 439.58 g/mol. Its IUPAC name is 5-methyl-5-[1-(4-phenylbutanoyl)piperidin-4-yl]-3-(thiophen-3-ylmethyl)imidazolidine-2,4-dione.
| Compound Name | 5-methyl-5-[1-(4-phenylbutanoyl)piperidin-4-yl]-3-(thiophen-3-ylmethyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 45183515 |
| Molecular Formula | C24H29N3O3S |
| Molecular Weight | 439.58 g/mol |
| Exact Mass | 439.19 |
| IUPAC Name | 5-methyl-5-[1-(4-phenylbutanoyl)piperidin-4-yl]-3-(thiophen-3-ylmethyl)imidazolidine-2,4-dione |
| SMILES | CC1(C2CCN(C(=O)CCCc3ccccc3)CC2)NC(=O)N(Cc2ccsc2)C1=O |
| InChI | InChI=1S/C24H29N3O3S/c1-24(22(29)27(23(30)25-24)16-19-12-15-31-17-19)20-10-13-26(14-11-20)21(28)9-5-8-18-6-3-2-4-7-18/h2-4,6-7,12,15,17,20H,5,8-11,13-14,16H2,1H3,(H,25,30) |
| InChIKey | BYYPJSMCDVMDGW-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.58 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|