C21H21N5O5S — CID 45180190
5-methyl-5-[1-(1-oxido-2,1,3-benzoxadiazol-1-ium-5-carbonyl)piperidin-4-yl]-3-(thiophen-3-ylmethyl)imidazolidine-2,4-dione (PubChem CID 45180190) has the molecular formula C21H21N5O5S and a molecular weight of 455.50 g/mol. Its IUPAC name is 5-methyl-5-[1-(1-oxido-2,1,3-benzoxadiazol-1-ium-5-carbonyl)piperidin-4-yl]-3-(thiophen-3-ylmethyl)imidazolidine-2,4-dione.
| Compound Name | 5-methyl-5-[1-(1-oxido-2,1,3-benzoxadiazol-1-ium-5-carbonyl)piperidin-4-yl]-3-(thiophen-3-ylmethyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 45180190 |
| Molecular Formula | C21H21N5O5S |
| Molecular Weight | 455.50 g/mol |
| Exact Mass | 455.13 |
| IUPAC Name | 5-methyl-5-[1-(1-oxido-2,1,3-benzoxadiazol-1-ium-5-carbonyl)piperidin-4-yl]-3-(thiophen-3-ylmethyl)imidazolidine-2,4-dione |
| SMILES | CC1(C2CCN(C(=O)c3ccc4c(c3)no[n+]4[O-])CC2)NC(=O)N(Cc2ccsc2)C1=O |
| InChI | InChI=1S/C21H21N5O5S/c1-21(19(28)25(20(29)22-21)11-13-6-9-32-12-13)15-4-7-24(8-5-15)18(27)14-2-3-17-16(10-14)23-31-26(17)30/h2-3,6,9-10,12,15H,4-5,7-8,11H2,1H3,(H,22,29) |
| InChIKey | ZVBZOJABRDEKAD-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 122.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.50 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'} |
|---|