C24H37N3O4 — CID 45192585
3-[(2,3-dimethoxyphenyl)methyl]-5-[1-(2-ethylbutyl)piperidin-4-yl]-5-methylimidazolidine-2,4-dione (PubChem CID 45192585) has the molecular formula C24H37N3O4 and a molecular weight of 431.58 g/mol. Its IUPAC name is 3-[(2,3-dimethoxyphenyl)methyl]-5-[1-(2-ethylbutyl)piperidin-4-yl]-5-methylimidazolidine-2,4-dione.
| Compound Name | 3-[(2,3-dimethoxyphenyl)methyl]-5-[1-(2-ethylbutyl)piperidin-4-yl]-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 45192585 |
| Molecular Formula | C24H37N3O4 |
| Molecular Weight | 431.58 g/mol |
| Exact Mass | 431.28 |
| IUPAC Name | 3-[(2,3-dimethoxyphenyl)methyl]-5-[1-(2-ethylbutyl)piperidin-4-yl]-5-methylimidazolidine-2,4-dione |
| SMILES | CCC(CC)CN1CCC(C2(C)NC(=O)N(Cc3cccc(OC)c3OC)C2=O)CC1 |
| InChI | InChI=1S/C24H37N3O4/c1-6-17(7-2)15-26-13-11-19(12-14-26)24(3)22(28)27(23(29)25-24)16-18-9-8-10-20(30-4)21(18)31-5/h8-10,17,19H,6-7,11-16H2,1-5H3,(H,25,29) |
| InChIKey | NKCFBDNHBFXYGP-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.58 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|