C18H24N4O2 — CID 118764069
N'-cyclopentyl-N-[(5-methyl-2H-indazol-3-yl)methyl]butanediamide (PubChem CID 118764069) has the molecular formula C18H24N4O2 and a molecular weight of 328.42 g/mol. Its IUPAC name is N'-cyclopentyl-N-[(5-methyl-2H-indazol-3-yl)methyl]butanediamide.
| Compound Name | N'-cyclopentyl-N-[(5-methyl-2H-indazol-3-yl)methyl]butanediamide |
|---|---|
| PubChem CID | 118764069 |
| Molecular Formula | C18H24N4O2 |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.19 |
| IUPAC Name | N'-cyclopentyl-N-[(5-methyl-2H-indazol-3-yl)methyl]butanediamide |
| SMILES | Cc1ccc2n[nH]c(CNC(=O)CCC(=O)NC3CCCC3)c2c1 |
| InChI | InChI=1S/C18H24N4O2/c1-12-6-7-15-14(10-12)16(22-21-15)11-19-17(23)8-9-18(24)20-13-4-2-3-5-13/h6-7,10,13H,2-5,8-9,11H2,1H3,(H,19,23)(H,20,24)(H,21,22) |
| InChIKey | WGEZOGPZTDCCMX-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |