C17H28N4O3 — CID 46989113
N'-cycloheptyl-N-[[3-(methoxymethyl)-1H-pyrazol-5-yl]methyl]butanediamide (PubChem CID 46989113) has the molecular formula C17H28N4O3 and a molecular weight of 336.44 g/mol. Its IUPAC name is N'-cycloheptyl-N-[[3-(methoxymethyl)-1H-pyrazol-5-yl]methyl]butanediamide.
| Compound Name | N'-cycloheptyl-N-[[3-(methoxymethyl)-1H-pyrazol-5-yl]methyl]butanediamide |
|---|---|
| PubChem CID | 46989113 |
| Molecular Formula | C17H28N4O3 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.22 |
| IUPAC Name | N'-cycloheptyl-N-[[3-(methoxymethyl)-1H-pyrazol-5-yl]methyl]butanediamide |
| SMILES | COCc1cc(CNC(=O)CCC(=O)NC2CCCCCC2)[nH]n1 |
| InChI | InChI=1S/C17H28N4O3/c1-24-12-15-10-14(20-21-15)11-18-16(22)8-9-17(23)19-13-6-4-2-3-5-7-13/h10,13H,2-9,11-12H2,1H3,(H,18,22)(H,19,23)(H,20,21) |
| InChIKey | RQZHFCGEUGAENP-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 96.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |