C16H18F4N2O2 — CID 75432991
N'-cyclopentyl-N-[(2,3,5,6-tetrafluorophenyl)methyl]butanediamide (PubChem CID 75432991) has the molecular formula C16H18F4N2O2 and a molecular weight of 346.32 g/mol. Its IUPAC name is N'-cyclopentyl-N-[(2,3,5,6-tetrafluorophenyl)methyl]butanediamide.
| Compound Name | N'-cyclopentyl-N-[(2,3,5,6-tetrafluorophenyl)methyl]butanediamide |
|---|---|
| PubChem CID | 75432991 |
| Molecular Formula | C16H18F4N2O2 |
| Molecular Weight | 346.32 g/mol |
| Exact Mass | 346.13 |
| IUPAC Name | N'-cyclopentyl-N-[(2,3,5,6-tetrafluorophenyl)methyl]butanediamide |
| SMILES | O=C(CCC(=O)NC1CCCC1)NCc1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C16H18F4N2O2/c17-11-7-12(18)16(20)10(15(11)19)8-21-13(23)5-6-14(24)22-9-3-1-2-4-9/h7,9H,1-6,8H2,(H,21,23)(H,22,24) |
| InChIKey | IOJZGOKBPYRGGE-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.32 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|