C17H19N3O4 — CID 118764186
(2S)-N-(2-cyclopropyl-1,3-dioxoisoindol-5-yl)-2-(hydroxymethyl)pyrrolidine-1-carboxamide (PubChem CID 118764186) has the molecular formula C17H19N3O4 and a molecular weight of 329.36 g/mol. Its IUPAC name is (2S)-N-(2-cyclopropyl-1,3-dioxoisoindol-5-yl)-2-(hydroxymethyl)pyrrolidine-1-carboxamide.
| Compound Name | (2S)-N-(2-cyclopropyl-1,3-dioxoisoindol-5-yl)-2-(hydroxymethyl)pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 118764186 |
| Molecular Formula | C17H19N3O4 |
| Molecular Weight | 329.36 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | (2S)-N-(2-cyclopropyl-1,3-dioxoisoindol-5-yl)-2-(hydroxymethyl)pyrrolidine-1-carboxamide |
| SMILES | O=C1c2ccc(NC(=O)N3CCC[C@H]3CO)cc2C(=O)N1C1CC1 |
| InChI | InChI=1S/C17H19N3O4/c21-9-12-2-1-7-19(12)17(24)18-10-3-6-13-14(8-10)16(23)20(15(13)22)11-4-5-11/h3,6,8,11-12,21H,1-2,4-5,7,9H2,(H,18,24)/t12-/m0/s1 |
| InChIKey | MWRVZTQBLGZHET-LBPRGKRZSA-N |
| XLogP | 1.43 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.36 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|