C14H22N6O — CID 118766750
1-[3-(3,5-dimethyl-1H-pyrazol-4-yl)propyl]-3-(1-ethylpyrazol-4-yl)urea (PubChem CID 118766750) has the molecular formula C14H22N6O and a molecular weight of 290.37 g/mol. Its IUPAC name is 1-[3-(3,5-dimethyl-1H-pyrazol-4-yl)propyl]-3-(1-ethylpyrazol-4-yl)urea.
| Compound Name | 1-[3-(3,5-dimethyl-1H-pyrazol-4-yl)propyl]-3-(1-ethylpyrazol-4-yl)urea |
|---|---|
| PubChem CID | 118766750 |
| Molecular Formula | C14H22N6O |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.19 |
| IUPAC Name | 1-[3-(3,5-dimethyl-1H-pyrazol-4-yl)propyl]-3-(1-ethylpyrazol-4-yl)urea |
| SMILES | CCn1cc(NC(=O)NCCCc2c(C)n[nH]c2C)cn1 |
| InChI | InChI=1S/C14H22N6O/c1-4-20-9-12(8-16-20)17-14(21)15-7-5-6-13-10(2)18-19-11(13)3/h8-9H,4-7H2,1-3H3,(H,18,19)(H2,15,17,21) |
| InChIKey | JCGLWOOIOZJIBE-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|