C16H28N4O2 — CID 121499826
1-[3-(3,5-dimethyl-1H-pyrazol-4-yl)propyl]-3-[(1-hydroxycyclohexyl)methyl]urea (PubChem CID 121499826) has the molecular formula C16H28N4O2 and a molecular weight of 308.43 g/mol. Its IUPAC name is 1-[3-(3,5-dimethyl-1H-pyrazol-4-yl)propyl]-3-[(1-hydroxycyclohexyl)methyl]urea.
| Compound Name | 1-[3-(3,5-dimethyl-1H-pyrazol-4-yl)propyl]-3-[(1-hydroxycyclohexyl)methyl]urea |
|---|---|
| PubChem CID | 121499826 |
| Molecular Formula | C16H28N4O2 |
| Molecular Weight | 308.43 g/mol |
| Exact Mass | 308.22 |
| IUPAC Name | 1-[3-(3,5-dimethyl-1H-pyrazol-4-yl)propyl]-3-[(1-hydroxycyclohexyl)methyl]urea |
| SMILES | Cc1n[nH]c(C)c1CCCNC(=O)NCC1(O)CCCCC1 |
| InChI | InChI=1S/C16H28N4O2/c1-12-14(13(2)20-19-12)7-6-10-17-15(21)18-11-16(22)8-4-3-5-9-16/h22H,3-11H2,1-2H3,(H,19,20)(H2,17,18,21) |
| InChIKey | KUYMSJGBSGXKRM-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 90.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.43 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|