C13H24N4O — CID 95893861
(3R)-3-[[3-(3,5-dimethyl-1H-pyrazol-4-yl)propylamino]methyl]pyrrolidin-3-ol (PubChem CID 95893861) has the molecular formula C13H24N4O and a molecular weight of 252.36 g/mol. Its IUPAC name is (3R)-3-[[3-(3,5-dimethyl-1H-pyrazol-4-yl)propylamino]methyl]pyrrolidin-3-ol.
| Compound Name | (3R)-3-[[3-(3,5-dimethyl-1H-pyrazol-4-yl)propylamino]methyl]pyrrolidin-3-ol |
|---|---|
| PubChem CID | 95893861 |
| Molecular Formula | C13H24N4O |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.20 |
| IUPAC Name | (3R)-3-[[3-(3,5-dimethyl-1H-pyrazol-4-yl)propylamino]methyl]pyrrolidin-3-ol |
| SMILES | Cc1n[nH]c(C)c1CCCNC[C@@]1(O)CCNC1 |
| InChI | InChI=1S/C13H24N4O/c1-10-12(11(2)17-16-10)4-3-6-14-8-13(18)5-7-15-9-13/h14-15,18H,3-9H2,1-2H3,(H,16,17)/t13-/m0/s1 |
| InChIKey | KLSBFWYSHMLJFR-ZDUSSCGKSA-N |
| XLogP | 0.27 |
| TPSA | 72.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|